flutter_andomie 0.6.36%2B1
SDKflutter
Platformandroidioswindowslinuxmacos
Collection of utils with advanced style and controlling system.
flutter_andomie
Collection of utils with advanced style and controlling system.
UTILS
MAP_COMPARISON
void main() {
final oldData = {
"launch_mode": true,
"secrets": {
"object": {
"active": "v1",
"versions": {
"v1": {
"version": "v1",
"key": "OLD_DOC_KEY",
"iv": "OLD_DOC_IV",
"secret": "OLD_DOC_SECRET"
}
}
},
"password": {
"active": "v1",
"versions": {
"v1": {
"version": "v1",
"key": "OLD_PASSWORD_KEY",
"iv": "OLD_PASSWORD_IV",
"secret": "OLD_PASSWORD_SECRET"
}
}
}
},
"notifications": {
"status": false,
"channels": [
{"id": "old_channel_id", "schedule": 12345}
],
"basics": [
{"id": "old_notification_id", "channel_id": 42}
]
}
};
final newData = {
"launch_mode": true,
"secrets": {
"object": {
"active": "v1",
"versions": {
"v1": {
"version": "v1",
"key": "THIS_IS_DOC_KEY",
"iv": "THIS_IS_DOC_IV",
"secret": "THIS_IS_DOC_SECRET"
}
}
},
"password": {
"active": "v1",
"versions": {
"v1": {
"version": "v1",
"key": "THIS_IS_PASSWORD_KEY",
"iv": "THIS_IS_PASSWORD_IV",
"secret": "THIS_IS_PASSWORD_SECRET"
}
}
}
},
"notifications": {
"status": true,
"channels": [
{
"id": "old_channel_id",
"schedule": 12345,
}
],
"basics": [
{
"id": "notification_id",
"channel_id": 95,
}
],
"randoms": [
[
{"id": "notification_id", "channel_id": 474}
]
]
}
};
// Basic comparison
final changes = MapComparison.compare(oldData, newData);
print('Basic changes:');
print('Added: ${changes['added']}');
print('Removed: ${changes['removed']}');
print('Modified: ${changes['modified']}');
// Detailed path comparison
final pathChanges = MapComparison.changes(oldData, newData);
print('\nPath changes: $pathChanges');
print('\isChanged: ${pathChanges.isChanged("notifications/randoms")}');
print('\isChanged: ${pathChanges.isChanged("secrets/object/")}');
print(
'\isChanged: ${pathChanges.isChanged("secrets/object/versions/v1/iv")}');
print('\nDetailed changes:');
print('Added paths:');
for (final path in pathChanges.added) {
print(' $path');
}
print('Removed paths:');
for (final path in pathChanges.removed) {
print(' $path');
}
print('Modified paths:');
for (final path in pathChanges.modified) {
print(' $path');
}
}
TRANSLATOR
void main() {
final digits = "1234567890.05";
// USE CASE 1
Translator.language = 'bn';
final a = digits.trNumber;
print(a); // ১২৩৪৫৬৭৮৯০.০৫
// USE CASE 2
final b = digits.translate(language: "ar");
print(b); // ١٢٣٤٥٦٧٨٩٠.٠٥
}
ROUTE_MANAGER
import 'dart:developer';
import 'package:flutter/material.dart';
import 'package:flutter_andomie/core.dart';
void main() async {
/// SEPARATOR:
/// '/'=> home/profile/details
/// '>'=> home>profile>details
RouteManager.separator = '/';
/// FILTER:
/// filter mode=> //home/profile/details///
/// normal mode=> home/profile/details
RouteManager.allowFilter = true;
/// MULTIPLE:
/// enabled=> home/details/details/details
/// disabled=> home/details
RouteManager.allowMultiple = true;
// RouteManager.ignorableRoutes = ['/notification']; // OPTIONAL
// RouteManager.supportedRoutes = ['/home', 'profile']; // OPTIONAL
// RouteManager.initialRoutes = 'home/'; // OPTIONAL
RouteManager.listen((value) {
log("ROUTE_MANAGER: $value");
});
runApp(const MyApp());
}
class MyApp extends StatelessWidget {
const MyApp({super.key});
@override
Widget build(BuildContext context) {
return MaterialApp(
title: 'Flutter Demo',
initialRoute: "/main",
routes: {
'/main': (context) => const Home(),
"/details": (context) => const DetailsPage(),
},
navigatorObservers: [RouteMonitor()],
);
}
}
class Home extends StatefulWidget {
const Home({super.key});
@override
State<Home> createState() => _HomeState();
}
class _HomeState extends State<Home> with SingleTickerProviderStateMixin {
int currentIndex = 0;
void _change(int index) {
final previous = ['home', 'notification', 'profile'][currentIndex];
final current = ['home', 'notification', 'profile'][index];
RouteManager.replace(current, previous);
setState(() => currentIndex = index);
}
@override
void initState() {
super.initState();
RouteManager.push("home");
}
@override
Widget build(BuildContext context) {
return Scaffold(
appBar: AppBar(
title: const Text("ROUTE MANAGER"),
),
bottomNavigationBar: BottomNavigationBar(
currentIndex: currentIndex,
onTap: _change,
items: const [
BottomNavigationBarItem(
icon: Icon(Icons.home),
label: "Home",
),
BottomNavigationBarItem(
icon: Icon(Icons.notifications),
label: "Notification",
),
BottomNavigationBarItem(
icon: Icon(Icons.person),
label: "Profile",
),
],
),
body: IndexedStack(
index: currentIndex,
children: List.generate(3, (index) {
return Center(
child: Text(
"TAB-${index + 1}\n${RouteManager.routes}",
textAlign: TextAlign.center,
),
);
}),
),
floatingActionButton: FloatingActionButton(
onPressed: () => Navigator.pushNamed(context, '/details'),
child: const Icon(Icons.ads_click, color: Colors.white),
),
);
}
}
class DetailsPage extends StatelessWidget {
const DetailsPage({super.key});
@override
Widget build(BuildContext context) {
return Scaffold(
appBar: AppBar(
title: const Text("Details Page"),
),
body: Container(
padding: const EdgeInsets.all(32),
alignment: Alignment.center,
child: Column(
mainAxisSize: MainAxisSize.min,
children: [
Text(
"DETAILS\n${RouteManager.routes}",
textAlign: TextAlign.center,
),
const SizedBox(height: 32),
ElevatedButton(
onPressed: () => Navigator.pushNamed(context, '/details'),
child: const Text("See details"),
),
],
),
),
);
}
}
SCREEN_SHOTS
Screen_recording_20241226_032302.webm
LAZY_NOTIFIER
class LazyNotifierExample extends StatefulWidget {
const LazyNotifierExample({super.key});
@override
State<LazyNotifierExample> createState() => _LazyNotifierExampleState();
}
class _LazyNotifierExampleState extends State<LazyNotifierExample> {
void _updateCounter() {
final previousValue = LazyNotifier.value<int>("counter_notifier") ?? 0;
LazyNotifier.notify("counter_notifier", value: previousValue + 1);
}
@override
void dispose() {
LazyNotifier.kill("counter_notifier");
super.dispose();
}
@override
Widget build(BuildContext context) {
return Scaffold(
appBar: AppBar(
title: const Text("Lazy Notifier Example"),
),
body: const Center(
child: CounterWidget(),
),
floatingActionButton: FloatingActionButton(
onPressed: _updateCounter,
child: const Icon(Icons.ads_click, color: Colors.white),
),
);
}
}
class CounterWidget extends StatelessWidget {
const CounterWidget({super.key});
@override
Widget build(BuildContext context) {
return ListenableBuilder(
listenable: LazyNotifier.of("counter_notifier"),
builder: (context, child) {
final counter = LazyNotifier.value<int>("counter_notifier");
return Text(
counter.toString(),
style: const TextStyle(
fontSize: 80,
fontWeight: FontWeight.bold,
),
);
},
);
}
}
TEXT_PARSER
void main() {
String normalText = "My name is Mr. X. I'm <CUSTOM_TAG_1><CUSTOM_TAG_2>24</CUSTOM_TAG_2></CUSTOM_TAG_1> old.";
List<SpanText> parsedText = TextParser.parse(normalText);
print(parsedText); // OUTPUT: [NormalText(text: My name is Mr. X. I'm ), SpannedText(text: 24, types: [CUSTOM_TAG_1, CUSTOM_TAG_2]), NormalText(text: old.)]
}
RAPID_CLICK
import 'dart:developer';
import 'package:flutter/material.dart';
import 'package:flutter_andomie/core.dart';
class RapidClickTester extends StatefulWidget {
const RapidClickTester({super.key});
@override
State<RapidClickTester> createState() => _RapidClickTesterState();
}
class _RapidClickTesterState extends State<RapidClickTester> {
int counter = 0;
void callback(bool rapid) {
log(rapid ? "RAPID_CLICK" : "NORMAL_CLICK");
setState(() => counter = RapidClick.count);
}
@override
Widget build(BuildContext context) {
return Scaffold(
body: Center(
child: Text(
counter.toString(),
style: const TextStyle(
fontSize: 80,
fontWeight: FontWeight.bold,
),
),
),
floatingActionButton: FloatingActionButton(
onPressed: () => RapidClick.click(callback),
child: const Icon(Icons.ads_click, color: Colors.white),
),
);
}
}
ISOLATION
void main() async {
final isolation = Isolation();
await isolation.initialize();
for (var i = 0; i < 10; i++) {
isolation.isolate(_task, i).then((value) {
print(value);
});
}
}
Future<Map> _task(index) async {
for (var i = 0; i < 10; i++) {
await Future.delayed(Duration(milliseconds: 10 * index as int));
print("Task $index: $i");
}
return {"data": "Complete this task: $index"};
}
ORDERED_LIST_SEQUENCE
class OrderedListView extends StatelessWidget {
final List<String> items;
OrderedListView({required this.items, required this.orderedListStyle});
@override
Widget build(BuildContext context) {
return ListView.builder(
itemCount: items.length,
itemBuilder: (context, index) {
// Format the index based on the selected ordered list style
String listPrefix = OrderedListSequence.lowerRoman.sequence(index);
return ListTile(
title: Text('$listPrefix) ${items[index]}'),
);
},
);
}
}
void main() {
runApp(MaterialApp(
home: Scaffold(
appBar: AppBar(title: Text('Ordered List View')),
body: OrderedListView(
items: ['Item 1', 'Item 2', 'Item 3', 'Item 4'],// Choose the style here
),
),
));
}
DATA_EXECUTOR
-
ExecutedData
- Represents data with a base and modified state.
- Provides methods to copy and modify the data.
- Implements equality and hash code based on the data contents.
-
DataExecutor
- Abstract class extending ValueNotifier to manage ExecutedData.
- Handles loading, converting, and fetching data.
- Provides methods to listen for data changes and execute conversions.
class MyDataExecutor extends DataExecutor<int, String> {
MyDataExecutor() : super();
@override
Future<String> convert(int root) async {
// Example conversion logic
return 'Converted $root';
}
@override
Future<Iterable<int>> fetch() async {
// Example fetch logic
return [1, 2, 3, 4, 5];
}
}
void main() {
// Example implementation of DataExecutor
final executor = MyDataExecutor();
// Listening for data changes
executor.listen((data) {
print('Data changed: $data');
});
// Execute loading and converting data
executor.load();
// Only notify listeners mode
executor.refresh();
// Re-fetch api data, when complete all data modified then notify all listeners
executor.refresh(true);
executor.listen((value) {}); // The listener gives both data (ex. base, modified)
executor.listenOnlyModified((value) {}); // The listener gives only modified data
}
SWIPE_LOCK_PROVIDER
- Initializes the swipe lock provider.
- Handles swipe actions and locks further swipes after a limit.
- Resets the swipe count and lockout status.
- Checks if swipe actions are locked and provides the remaining lockout duration.
late SharedPreferences _kPreferences;
// Mock implementations for reader and writer
int? mockReader(String key) {
return _kPreferences.getInt(key); // Check previous lock from local db
}
void mockWriter(String key, int value) {
_kPreferences.setInt(key, value); // Save lock instance in local db
}
void main() async {
// Initialize SharedPreferences (Optional)
_kPreferences = await SharedPreferences.getInstance();
// Initialize SwipeLockProvider
SwipeLockProvider.init(
times: 5,
lockoutDuration: Duration(hours: 8),
reader: mockReader,
writer: mockWriter,
);
// Example 1: Check if currently locked
bool isLocked = SwipeLockProvider.instance.isLocked;
print(isLocked); // Output: false
// Example 2: Perform a swipe action
SwipeLockProvider.instance.swipe();
print(SwipeLockProvider.instance.isLocked); // Output depends on swipe count
// Example 3: Reset the swipe count and lockout status
SwipeLockProvider.instance.reset();
print(SwipeLockProvider.instance.isLocked); // Output: false
// Example 4: Get remaining lockout duration
Duration remaining = SwipeLockProvider.instance.remaining;
print(remaining.inMinutes); // Output: 480 (if locked) or 0 (if not locked)
// Example 5: Listen provider change
SwipeLockProvider.instance.addListener(_onLockChanged);
// Example 5: Listen provider remove
SwipeLockProvider.instance.removeListener(_onLockChanged);
}
UNDO MANAGER
- A simple undo manager to keep track of actions and allow undoing the last action.
- Adds, inserts, and removes actions in a list.
- Retrieves the length of the list.
void main() {
// Example 1: Add and undo actions
UndoManager<String> manager = UndoManager<String>();
manager.add("Action 1");
manager.add("Action 2");
print(manager.undo()); // Output: Action 2
print(manager.undo()); // Output: Action 1
print(manager.undo()); // Output: null
// Example 2: Insert and undo actions
manager.add("Action 1");
manager.insert(0, "Action 0");
print(manager.undo()); // Output: Action 1
print(manager.undo()); // Output: Action 0
}
NUMBER
- Real number to human readable numbers. (ex: 1.1K, 1.5M, 1B etc)
- Real bytes to human readable bytes. (ex: 120.56 KB, 117.74 MB, 11.5 GB, etc)
- Human readable number to real numbers. (ex: 10000, 1500000, 1000000000 etc)
- Human readable bytes to real bytes. (ex: 1024, 4759737, 8374587347 etc)
void main() {
// Example 1: Convert number to readable bytes
Readable readableBytes = Number.toReadableBytes(2048);
print(readableBytes); // Output: 2.00 KB
// Example 2: Convert number to readable number
Readable readableNumber = Number.toReadableNumber(1500000);
print(readableNumber); // Output: 1.5 M
// Example 3: Use unit methods
print(ByteUnits.auto.read(2048)); // Output: 2.00 KB
print(NumberUnits.auto.read(1500000)); // Output: 1.5 M
// Example 4: Use extension methods
print(2048.toReadableBytes()); // Output: 2.00 KB
print(1500000.toReadableNumber()); // Output: 1.5 M
// Example 1: Convert readable bytes to real bytes
double realBytes = Number.toRealBytes(2, ByteUnits.kb);
print(realBytes); // Output: 2048.00
// Example 2: Convert readable number to real number
double realNumbers = Number.toRealNumber(1.5, NumberUnits.m);
print(realNumbers); // Output: 1500000.00
// Example 3: Use unit methods
print(ByteUnits.kb.write(2)); // Output: 2048.00
print(NumberUnits.m.write(1.5)); // Output: 1500000.00
// Example 4: Use extension methods
print(2.toRealBytes(ByteUnits.kb)); // Output: 2048.00
print(1.5.toRealNumber(NumberUnits.m)); // Output: 1500000.00
}
COLOR_GENERATOR
- Generate a single random color
- Generate a list of random colors
- Generate a list of colors from a provided list with random alpha values
- Pick a color from existing colors by sequence or index
void main() {
// Example 1: Generate a single random color
Color randomColor = ColorGenerator.generate(minOpacity: 100, maxOpacity: 200);
print(randomColor); // Output: Color with random ARGB values
// Example 2: Generate a list of random colors
List<Color> randomColors = ColorGenerator.generates(length: 5);
randomColors.forEach((color) => print(color)); // Output: List of random colors
// Example 3: Generate a list of colors from a provided list with random alpha values
List<Color> baseColors = [Color(0xFFFF0000), Color(0xFF00FF00), Color(0xFF0000FF)];
List<Color> customColors = ColorGenerator.generates(length: 3, colors: baseColors);
customColors.forEach((color) => print(color)); // Output: List of colors with random alpha
// Example 3: Pick a color from existing colors by sequence or index
ColorGenerator.init([Colors.red, Colors.blue, Colors.green]);
Color pickedColor = ColorGenerator.i.pick(); // Sequence ways
}
IN_APP_ICON
- Three state asset icon paths. (Ex. regular, solid, bold)
void main() {
InAppIcon home = InAppIcon.svg("ic_home");
print(home.regular); // assets/icons/ic_home_regular.svg
print(home.solid); // assets/icons/ic_home_solid.svg
print(home.bold); // assets/icons/ic_home_bold.svg
InAppIcon notification = InAppIcon.png("ic_notification");
print(notification.regular); // assets/icons/ic_notification_regular.png
print(notification.solid); // assets/icons/ic_notification_solid.png
print(notification.bold); // assets/icons/ic_notification_bold.png
}
ITERATOR_HELPER
void main() {
final items = [0, 1, 2, 3, 4, 5, 6, 7, 8, 9];
// Use convertAs operation to convert all data
final allItemAsText = items.convertAs("", (value, element) {
return "$value $element";
});
print("All number as text: $allItemAsText"); // All number as text: 0 1 2 3 4 5 6 7 8 9
// Use convertAsyncAs operation to convert all future data
items.convertAsyncAs(0, (value, element) async {
return value + await Future.value(element);
}).then((value) {
print("Total: $value"); // Total: 45
});
// Use customizeAs operation to customize all data with validation check
final allEvenNumbers = items.customizeAs((element) {
return element;
}, (value) {
return value.isEven;
});
print("All even numbers: $allEvenNumbers"); // All even numbers: [0, 2, 4, 6, 8]
// Use customizeAsyncAs operation to customize all future data with validation check
items.customizeAsyncAs(
(element) async {
return await Future.value(element);
},
(value) {
return value.isOdd;
},
).then((value) {
print("All odd numbers: $value"); // All odd numbers: [1, 3, 5, 7, 9]
});
List<String> cards = items.to(reverse: true, limit: 5, (index, element) {
return element.toString();
});
print(cards); // [50, 49, 48, 47, 46]
// Use findIndex operation to find index with null safety
final index = items.findIndex(-1, (element) => element == 5);
print("index: $index"); // index: 4
}
HIT_LOGGER
import 'dart:developer';
import 'package:flutter/material.dart';
import 'package:flutter_andomie/core.dart';
void main() async {
HitLogger.init(
name: "LOGGER_APP",
onCheck: (tag, value) {
log("$tag => $value");
},
onListen: (value) {
log(value);
},
onClientCheck: (value) {
return value == "CLIENT-1";
},
onClientListen: (value) {
log(value.toString());
},
);
runApp(const Application());
}
Future<String> futureData() async {
await Future.delayed(const Duration(seconds: 30));
return "Hi, I'm a future data...!";
}
Stream<String> streamData() {
return Stream.periodic(const Duration(seconds: 5), (event) {
return "Hi, I'm a stream data... $event!";
});
}
class Application extends StatefulWidget {
const Application({super.key});
@override
State<Application> createState() => _ApplicationState();
}
class _ApplicationState extends State<Application> {
@override
void initState() {
futureData().hitLogger("getMessage", "CLIENT-1").then((value) {
// log(value);
});
streamData().hitLogger("listenMessage", "CLIENT-1").listen((event) {
// log(event);
});
super.initState();
}
@override
Widget build(BuildContext context) {
return MaterialApp(
title: 'Api hit counter',
home: Scaffold(
body: Column(
crossAxisAlignment: CrossAxisAlignment.center,
mainAxisAlignment: MainAxisAlignment.center,
children: [
FutureBuilder(
future: futureData().hitLogger("futureData", "CLIENT-2"),
builder: (context, snapshot) {
return Text(snapshot.data ?? "");
},
),
const SizedBox(height: 24),
StreamBuilder(
stream: streamData().hitLogger("streamData", "CLIENT-2"),
builder: (context, snapshot) {
return Text(snapshot.data ?? "");
},
),
],
),
),
);
}
}
Fetching data... Data fetched successfully! Total Hits: API_HIT_LOGGER { -> init : 1 -> listen : 1 -> request : 1 -> response : 1 } API_HIT_LOGGER (client_1) { -> init
LOG_BUILDER
void main() {
// Create a LogBuilder instance with the tag "ExampleTag"
LogBuilder logger = LogBuilder.getInstance("ExampleTag");
// Attach some name-value pairs
logger.attach("Key1", "Value1")
.attach("Key2", 42);
// Start a new attachment section
logger.attachStart("SectionName")
.attach("SectionKey", "SectionValue")
.attachEnd("SectionEndKey", 3.14);
// Put a name-value pair directly
logger.put("DirectKey", true);
// Put a name and a list of data directly
logger.puts("ListKey", [1, 2, 3, 4, 5]);
// Build and log the final result
logger.build();
}
ExampleTag { -> Key1 = Value1, Key2 = 42, -> SectionName -> SectionKey : SectionValue, SectionEndKey = 3.14 ] -> DirectKey : true -> ListKey : [1, 2, 3... 5] }
PAGINATION
void main() {
// Example usage of PaginationController and Pagination
PaginationController paginationController = PaginationController();
// Simulate loading more data asynchronously
Future<bool> simulateLoading() async {
await Future.delayed(Duration(seconds: 2));
return true;
}
// Callback triggered when loading is required
void onLoadMore() {
print("Loading more items...");
// Add logic to load more items
}
// Enable pagination for the associated ListView
paginationController.paginate(
preload: 500, // Customize the preload distance
onLoad: onLoadMore,
onLoading: simulateLoading,
);
}
PATH_FINDER
void main() {
// Example 1: Valid path
String validPath = "users/john/posts";
PathInfo validPathInfo = PathFinder.info(validPath);
print(validPathInfo); // Output: Invalid: false, Ending: posts, Pairs: [Pair(users : john)]
// Example 2: Invalid path
String invalidPath = "invalid path";
PathInfo invalidPathInfo = PathFinder.info(invalidPath);
print(invalidPathInfo); // Output: Invalid: true, Ending: , Pairs: []
// Example 3: Extracting segments
String pathWithSegments = "path/with/more/segments";
List<String> pathSegments = PathFinder.segments(pathWithSegments);
print(pathSegments); // Output: [path, with, more, segments]
}
PATH_REPLACER
void main() {
// Using replace method
Map<String, String> params = {'param1': 'value1', 'param2': 'value2'};
String result = PathReplacer.replace('/path/{param1}/endpoint/{param2}', params);
print(result); // Output: '/path/value1/endpoint/value2'
// Using replaceByIterable method
Iterable<String> iterableParams = ['value1', 'value2'];
result = PathReplacer.replaceByIterable('/path/{param1}/endpoint/{param2}', iterableParams);
print(result); // Output: '/path/value1/endpoint/value2'
}
PROVIDER
import '../utils.dart'; // Assuming the utils.dart file is in the parent directory
void main() {
// Sample list of fruits
List<String> fruits = ['Apple', 'Banana', 'Orange', 'Grapes'];
// Query to find the suggested position
String query = 'Banana';
// Get the suggested position for the query in the list of fruits
int suggestedPosition = Provider.getSuggestedPosition(query, fruits);
// Display the result
if (suggestedPosition < fruits.length) {
print('Suggested position for "$query": $suggestedPosition');
} else {
print('Item "$query" not found in the list.');
}
}
RANDOM_PROVIDER
void main() {
// Using getInt method
int randomInt = RandomProvider.getInt(max: 10, min: 5, seed: 42);
print(randomInt); // Output: Random integer between 5 (inclusive) and 10 (exclusive).
// Using getString method
String randomString = RandomProvider.getString(data: 'abc123', max: 8, seed: 42);
print(
randomString); // Output: Random string of length 8 using characters 'a', 'b', 'c', '1', '2', '3'.
// Using getValue method
List<String> options = ['A', 'B', 'C', 'D'];
String? randomValue = RandomProvider.getValue(data: options, max: 4, min: 1, seed: 42);
print(randomValue); // Output: Random value from the list ['B', 'C', 'D'].
// Using getList method
List<String> randomList = RandomProvider.getList(data: options, size: 3, min: 1, seed: 42);
print(randomList); // Output: List of 3 random values from the list ['B', 'C', 'D'].
}
RANK_GENERATOR
import '../utils.dart'; // Assuming this is the correct path to your utils.dart file
void main() {
// Create a RankGenerator with a percentage threshold of 50%
RankGenerator rankGenerator = RankGenerator(percentage: 50);
// Initialize the RankGenerator with a total value
rankGenerator.init(100);
// Add a listener to be notified when a rank is generated
rankGenerator.addListener((int value) {
print('Rank $value generated!');
});
// Simulate progress updates
for (int i = 0; i <= 100; i += 10) {
// Update the RankGenerator with the current progress value
rankGenerator.update(i);
}
}
REPLACEMENT
void main() {
// Using auto method for automatic replacements
String autoResult = Replacement.auto("Hello! How are you?");
print('Auto Result: $autoResult'); // Output: 'Hello How are you'
// Using single method for specific character replacement
String singleResult = Replacement.single("Hello, World!", "-", ["!"]);
print('Single Result: $singleResult'); // Output: 'Hello, World-'
// Using multiple method for multiple character replacements
String multipleResult = Replacement.multiple("Hello, World!", ["_", "+"], [" ", "!"]);
print('Multiple Result: $multipleResult'); // Output: 'Hello+_World_'
}
SINGLETON
class AppConfig {
final String appName;
final String version;
AppConfig._(this.appName, this.version);
static AppConfig get instance => Singleton.instanceOf(() => AppConfig._("MyApp", "1.0.0"));
}
void main() {
// Get a singleton instance of AppConfig
AppConfig appConfig = AppConfig.instance;
// Access properties of the singleton instance
print("App Name: ${appConfig.appName}");
print("Version: ${appConfig.version}");
}
SIZE_CONFIG
import 'package:flutter/material.dart';
// Assume that SizeConfig is defined in '../utils.dart'
void main() {
runApp(MyApp());
}
class MyApp extends StatelessWidget {
@override
Widget build(BuildContext context) {
// Initializing SizeConfig
SizeConfig sizeConfig = SizeConfig(context);
return MaterialApp(
home: Scaffold(
appBar: AppBar(
title: Text('SizeConfig Example'),
),
body: Center(
child: Column(
mainAxisAlignment: MainAxisAlignment.center,
children: [
Text(
'Screen Width: ${sizeConfig.screenWidth}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Screen Height: ${sizeConfig.screenHeight}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Is Mobile: ${sizeConfig.isMobile}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Is Tablet: ${sizeConfig.isTab}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Is Desktop: ${sizeConfig.isDesktop}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Diagonal Size: ${sizeConfig.diagonal}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Percentage Width (50%): ${sizeConfig.percentageWidth(50)}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Suggested Pixel (50%): ${sizeConfig.pixelPercentage(50)}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
Text(
'Divided Space (2): ${sizeConfig.dividedSpace(2)}',
style: TextStyle(fontSize: sizeConfig.fontSize(18)),
),
],
),
),
),
);
}
}
SLEEPING_TIMER
void main() {
SleepingTimer sleepingTimer = SleepingTimer(Duration(seconds: 5));
// Set onComplete listener
sleepingTimer.setOnCompleteListener(() {
print('Sleep complete!');
});
// Set onRemaining listener
sleepingTimer.setOnRemainingListener((remaining) {
print('Time remaining: $remaining');
});
// Start the timer
sleepingTimer.start();
}
TEXT_FORMAT
void main() {
// Creating a TextFormat instance for 'apple' with a plural form 'apples'
final like = TextFormat(singular: 'like', plural: 'likes');
// Using the apply method to get the appropriate form based on the counter
print('You have 1 ${like.apply(1)}'); // Output: You have 1 like
print('You have 5 ${like.apply(5)}'); // Output: You have 5 likes
}
PATTERNS
void main() {
// Example for checking if a string is a digit with up to two decimal places
print(Patterns.digit.hasMatch('123')); // true
print(Patterns.digit.hasMatch('123.45')); // true
print(Patterns.digit.hasMatch('123.456')); // false (more than two decimal places)
print(Patterns.digit.hasMatch('abc')); // false (non-digit characters)
// Example for checking if a string is numeric (with an optional negative sign)
print(Patterns.numeric.hasMatch('123')); // true
print(Patterns.numeric.hasMatch('-456')); // true
print(Patterns.numeric.hasMatch('12.34')); // false (contains decimal point)
print(Patterns.numeric.hasMatch('abc')); // false (non-numeric characters)
// Example for checking if a string contains only letters
print(Patterns.letter.hasMatch('abc')); // true
print(Patterns.letter.hasMatch('abc123')); // false (contains numeric characters)
// Example for validating an email address
print(Patterns.email.hasMatch('user@example.com')); // true
print(Patterns.email.hasMatch('invalid-email')); // false (missing @ and domain)
print(Patterns.email.hasMatch('user@.com')); // false (missing domain)
// Example for validating a username (alphanumeric and underscores, length 3 to 16)
print(Patterns.username.hasMatch('user123')); // true
print(Patterns.username.hasMatch('user_name')); // true
print(Patterns.username.hasMatch('u')); // false (less than 3 characters)
print(Patterns.username.hasMatch('username_with_space')); // false (contains space)
// Example for validating a username with dots (alphanumeric, underscores, and dots, length 3 to 16)
print(Patterns.usernameWithDot.hasMatch('user.123')); // true
print(Patterns.usernameWithDot.hasMatch('user_name.dot')); // true
print(Patterns.usernameWithDot.hasMatch('u')); // false (less than 3 characters)
print(
Patterns.usernameWithDot.hasMatch('invalid.username')); // false (contains invalid characters)
// Example for validating different phone number formats
print(Patterns.phone2.hasMatch('1234567890')); // true
print(Patterns.phone2.hasMatch('+123456789012')); // true
print(Patterns.phone2.hasMatch('invalid-phone-number')); // false (contains invalid characters)
// Example for validating a URL
print(Patterns.url.hasMatch('https://www.example.com')); // true
print(Patterns.url.hasMatch('invalid-url')); // false (missing protocol)
// Example for validating a path with a hierarchical structure
print(Patterns.path3.hasMatch('path/to/something')); // true
print(Patterns.path3.hasMatch('invalid/path with spaces')); // false (contains spaces)
}
VALIDATOR
void main() {
// Print function calls and expected output
// Validator equals
print("Validator equals: ${Validator.equals(42, 42)}"); // Output: true
// Validator isChecked
print(
"Validator isChecked: ${Validator.isChecked("apple", ["apple", "banana"])}"); // Output: true
// Validator isMatched
print("Validator isMatched: ${Validator.isMatched("hello", "hello")}"); // Output: true
// Validator isMatchedList
print("Validator isMatchedList: ${Validator.isMatchedList(
["a", "b"], ["a", "b"])}"); // Output: true
// Validator isDigit
print("Validator isDigit: ${Validator.isDigit("123")}"); // Output: true
// Validator isLetter
print("Validator isLetter: ${Validator.isLetter("abc")}"); // Output: true
// Validator isNumeric
print("Validator isNumeric: ${Validator.isNumeric("42.5")}"); // Output: true
// Validator isValidDay
print("Validator isValidDay: ${5.isValidDay}"); // Output: true
// Validator isValidDigit
print("Validator isValidDigit: ${"42".isValidDigit}"); // Output: true
// Validator isValidEmail
print("Validator isValidEmail: ${"user@example.com".isValidEmail()}"); // Output: true
// Validator isValidMonth
print("Validator isValidMonth: ${12.isValidMonth}"); // Output: true
// Validator isValidPath
print("Validator isValidPath: ${"/path/to/resource".isValidPath()}"); // Output: true
// Validator isValidPhone
print("Validator isValidPhone: ${"+123456789".isValidPhone()}"); // Output: true
// Validator isValidRetypePassword
print("Validator isValidRetypePassword: ${Validator.isValidRetypePassword(
"password", "password")}"); // Output: true
// Validator isValidPassword
print("Validator isValidPassword: ${"securePwd".isValidPassword()}"); // Output: true
// Validator isValidUsername
print("Validator isValidUsername: ${"user_123".isValidUsername()}"); // Output: true
// Validator isValidYear
print("Validator isValidYear: ${1990.isValidYear(18)}"); // Output: true
// Validator isValidDigitWithLetter
print("Validator isValidDigitWithLetter: ${"123abc".isValidDigitWithLetter}"); // Output: true
// Validator isValidDigitWithPlus
print("Validator isValidDigitWithPlus: ${"+123".isValidDigitWithPlus}"); // Output: true
// Validator isValidLetter
print("Validator isValidLetter: ${"abc".isValidLetter}"); // Output: true
// Validator isValidList
print("Validator isValidList: ${[1, 2, 3].isValidList}"); // Output: true
// Validator isValidSet
print("Validator isValidSet: ${{1, 2, 3}.isValidSet}"); // Output: true
// Validator isValidObject
print("Validator isValidObject: ${42.isValidObject}"); // Output: true
// Validator isInstance
print("Validator isInstance: ${42.isInstance<int>}"); // Output: true
// Validator isValidString
print("Validator isValidString: ${"Hello World".isValidString()}"); // Output: true
// Validator isValidStrings
print("Validator isValidStrings: ${["apple", "orange"].isValidStrings()}"); // Output: true
// Validator isValidWebURL
print("Validator isValidWebURL: ${"https://example.com".isValidWebURL}"); // Output: true
// Validator isRank
print("Validator isRank: ${4.5.isRank(4.0)}"); // Output: true
}